C13H20BrNOS — CID 114210698
3-bromo-4-(4,4-dimethylpentylsulfinyl)aniline (PubChem CID 114210698) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-bromo-4-(4,4-dimethylpentylsulfinyl)aniline.
| Compound Name | 3-bromo-4-(4,4-dimethylpentylsulfinyl)aniline |
|---|---|
| PubChem CID | 114210698 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-bromo-4-(4,4-dimethylpentylsulfinyl)aniline |
| SMILES | CC(C)(C)CCCS(=O)c1ccc(N)cc1Br |
| InChI | InChI=1S/C13H20BrNOS/c1-13(2,3)7-4-8-17(16)12-6-5-10(15)9-11(12)14/h5-6,9H,4,7-8,15H2,1-3H3 |
| InChIKey | NOKADCAOTKCSNQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|