C10H11ClF3NOS — CID 113327587
3-chloro-4-(4,4,4-trifluorobutylsulfinyl)aniline (PubChem CID 113327587) has the molecular formula C10H11ClF3NOS and a molecular weight of 285.72 g/mol. Its IUPAC name is 3-chloro-4-(4,4,4-trifluorobutylsulfinyl)aniline.
| Compound Name | 3-chloro-4-(4,4,4-trifluorobutylsulfinyl)aniline |
|---|---|
| PubChem CID | 113327587 |
| Molecular Formula | C10H11ClF3NOS |
| Molecular Weight | 285.72 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-chloro-4-(4,4,4-trifluorobutylsulfinyl)aniline |
| SMILES | Nc1ccc(S(=O)CCCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClF3NOS/c11-8-6-7(15)2-3-9(8)17(16)5-1-4-10(12,13)14/h2-3,6H,1,4-5,15H2 |
| InChIKey | WQKXKHKBBZCNDG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|