C11H15NOS2 — CID 65262840
2,2-dimethyl-5-thiophen-2-ylsulfinylpentanenitrile (PubChem CID 65262840) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-thiophen-2-ylsulfinylpentanenitrile.
| Compound Name | 2,2-dimethyl-5-thiophen-2-ylsulfinylpentanenitrile |
|---|---|
| PubChem CID | 65262840 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2,2-dimethyl-5-thiophen-2-ylsulfinylpentanenitrile |
| SMILES | CC(C)(C#N)CCCS(=O)c1cccs1 |
| InChI | InChI=1S/C11H15NOS2/c1-11(2,9-12)6-4-8-15(13)10-5-3-7-14-10/h3,5,7H,4,6,8H2,1-2H3 |
| InChIKey | RYJZHVKNBAKDKP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |