C15H24N2S — CID 80526708
2,2-dimethyl-5-[(2-methyl-2-thiophen-2-ylpropyl)amino]pentanenitrile (PubChem CID 80526708) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(2-methyl-2-thiophen-2-ylpropyl)amino]pentanenitrile.
| Compound Name | 2,2-dimethyl-5-[(2-methyl-2-thiophen-2-ylpropyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 80526708 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2,2-dimethyl-5-[(2-methyl-2-thiophen-2-ylpropyl)amino]pentanenitrile |
| SMILES | CC(C)(C#N)CCCNCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C15H24N2S/c1-14(2,11-16)8-6-9-17-12-15(3,4)13-7-5-10-18-13/h5,7,10,17H,6,8-9,12H2,1-4H3 |
| InChIKey | KLQZOUWADHJFGZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|