C17H20N2OS — CID 80526804
4-[1-hydroxy-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethyl]benzonitrile (PubChem CID 80526804) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethyl]benzonitrile.
| Compound Name | 4-[1-hydroxy-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 80526804 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[1-hydroxy-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethyl]benzonitrile |
| SMILES | CC(C)(CNCC(O)c1ccc(C#N)cc1)c1cccs1 |
| InChI | InChI=1S/C17H20N2OS/c1-17(2,16-4-3-9-21-16)12-19-11-15(20)14-7-5-13(10-18)6-8-14/h3-9,15,19-20H,11-12H2,1-2H3 |
| InChIKey | WGIXWZVWARGRNR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |