C16H20ClNOS — CID 80526598
1-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethanol (PubChem CID 80526598) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 80526598 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]ethanol |
| SMILES | CC(C)(CNCC(O)c1ccccc1Cl)c1cccs1 |
| InChI | InChI=1S/C16H20ClNOS/c1-16(2,15-8-5-9-20-15)11-18-10-14(19)12-6-3-4-7-13(12)17/h3-9,14,18-19H,10-11H2,1-2H3 |
| InChIKey | HHUVUMDCJYMBHI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |