C16H19ClN2OS — CID 80526835
N-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]acetamide (PubChem CID 80526835) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 80526835 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]acetamide |
| SMILES | CC(C)(CNCC(=O)Nc1ccccc1Cl)c1cccs1 |
| InChI | InChI=1S/C16H19ClN2OS/c1-16(2,14-8-5-9-21-14)11-18-10-15(20)19-13-7-4-3-6-12(13)17/h3-9,18H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | MIZOWHNQRHVQLB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |