C13H20ClN3O3S — CID 63859682
N-(2-chlorophenyl)-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]acetamide (PubChem CID 63859682) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 63859682 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]acetamide |
| SMILES | CC(C)(CNCC(=O)Nc1ccccc1Cl)NS(C)(=O)=O |
| InChI | InChI=1S/C13H20ClN3O3S/c1-13(2,17-21(3,19)20)9-15-8-12(18)16-11-7-5-4-6-10(11)14/h4-7,15,17H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | CXTPGUQCPNRCTA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |