C11H11ClF4N2O — CID 106291849
N-(2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropylamino)acetamide (PubChem CID 106291849) has the molecular formula C11H11ClF4N2O and a molecular weight of 298.67 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropylamino)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
|---|---|
| PubChem CID | 106291849 |
| Molecular Formula | C11H11ClF4N2O |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)C(F)F)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H11ClF4N2O/c12-7-3-1-2-4-8(7)18-9(19)5-17-6-11(15,16)10(13)14/h1-4,10,17H,5-6H2,(H,18,19) |
| InChIKey | QJXGPHBNUBOJNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|