C13H20N2O3S — CID 78963918
ethyl 2-[(2-methyl-2-thiophen-2-ylpropyl)carbamoylamino]acetate (PubChem CID 78963918) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-2-thiophen-2-ylpropyl)carbamoylamino]acetate.
| Compound Name | ethyl 2-[(2-methyl-2-thiophen-2-ylpropyl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 78963918 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | ethyl 2-[(2-methyl-2-thiophen-2-ylpropyl)carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C13H20N2O3S/c1-4-18-11(16)8-14-12(17)15-9-13(2,3)10-6-5-7-19-10/h5-7H,4,8-9H2,1-3H3,(H2,14,15,17) |
| InChIKey | BVHWJLVUKKHVIH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |