C12H21ClN2O2S — CID 120989918
2-amino-3-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)propanamide;hydrochloride (PubChem CID 120989918) has the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)propanamide;hydrochloride.
| Compound Name | 2-amino-3-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120989918 |
| Molecular Formula | C12H21ClN2O2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-amino-3-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)propanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NCC(C)(C)c1cccs1.Cl |
| InChI | InChI=1S/C12H20N2O2S.ClH/c1-12(2,10-5-4-6-17-10)8-14-11(15)9(13)7-16-3;/h4-6,9H,7-8,13H2,1-3H3,(H,14,15);1H |
| InChIKey | QUDIWFRJSQZRID-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |