C17H23NOS — CID 80526261
2-methyl-N-(3-phenoxypropyl)-2-thiophen-2-ylpropan-1-amine (PubChem CID 80526261) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-methyl-N-(3-phenoxypropyl)-2-thiophen-2-ylpropan-1-amine.
| Compound Name | 2-methyl-N-(3-phenoxypropyl)-2-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 80526261 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-methyl-N-(3-phenoxypropyl)-2-thiophen-2-ylpropan-1-amine |
| SMILES | CC(C)(CNCCCOc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C17H23NOS/c1-17(2,16-10-6-13-20-16)14-18-11-7-12-19-15-8-4-3-5-9-15/h3-6,8-10,13,18H,7,11-12,14H2,1-2H3 |
| InChIKey | LLBYJANTMHFCQP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|