C16H26ClNO — CID 106141093
5-chloro-2,2-dimethyl-N-(3-phenoxypropyl)pentan-1-amine (PubChem CID 106141093) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-N-(3-phenoxypropyl)pentan-1-amine.
| Compound Name | 5-chloro-2,2-dimethyl-N-(3-phenoxypropyl)pentan-1-amine |
|---|---|
| PubChem CID | 106141093 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-chloro-2,2-dimethyl-N-(3-phenoxypropyl)pentan-1-amine |
| SMILES | CC(C)(CCCCl)CNCCCOc1ccccc1 |
| InChI | InChI=1S/C16H26ClNO/c1-16(2,10-6-11-17)14-18-12-7-13-19-15-8-4-3-5-9-15/h3-5,8-9,18H,6-7,10-14H2,1-2H3 |
| InChIKey | HPHAQTPGUMWSTI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|