C16H26ClNO — CID 106141104
5-chloro-N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpentan-1-amine (PubChem CID 106141104) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpentan-1-amine.
| Compound Name | 5-chloro-N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 106141104 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-chloro-N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpentan-1-amine |
| SMILES | COc1ccc(CCNCC(C)(C)CCCCl)cc1 |
| InChI | InChI=1S/C16H26ClNO/c1-16(2,10-4-11-17)13-18-12-9-14-5-7-15(19-3)8-6-14/h5-8,18H,4,9-13H2,1-3H3 |
| InChIKey | OLSQXYMAQHJZMT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|