C17H26N2OS — CID 80526849
2-cyano-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propylpentanamide (PubChem CID 80526849) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-cyano-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propylpentanamide.
| Compound Name | 2-cyano-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propylpentanamide |
|---|---|
| PubChem CID | 80526849 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-cyano-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propylpentanamide |
| SMILES | CCCC(C#N)(CCC)C(=O)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C17H26N2OS/c1-5-9-17(12-18,10-6-2)15(20)19-13-16(3,4)14-8-7-11-21-14/h7-8,11H,5-6,9-10,13H2,1-4H3,(H,19,20) |
| InChIKey | UTBYYPCXXCEOEB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |