C13H17F3N2O2S — CID 75451079
N-(2-methyl-2-thiophen-2-ylpropyl)-N'-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 75451079) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-N'-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-N'-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 75451079 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-N'-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | CC(C)(CNC(=O)CC(=O)NCC(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-12(2,9-4-3-5-21-9)7-17-10(19)6-11(20)18-8-13(14,15)16/h3-5H,6-8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | RPIHUWUYWDNLAH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|