C14H21NOS2 — CID 107032820
N-(2-methyl-2-thiophen-2-ylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107032820) has the molecular formula C14H21NOS2 and a molecular weight of 283.46 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107032820 |
| Molecular Formula | C14H21NOS2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | CC(C)(CNC(=O)CC1(CS)CC1)c1cccs1 |
| InChI | InChI=1S/C14H21NOS2/c1-13(2,11-4-3-7-18-11)9-15-12(16)8-14(10-17)5-6-14/h3-4,7,17H,5-6,8-10H2,1-2H3,(H,15,16) |
| InChIKey | VQLKPCUDFGXAQI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|