C15H24N2OS2 — CID 80527462
2-carbamothioyl-2-ethyl-N-(2-methyl-2-thiophen-2-ylpropyl)butanamide (PubChem CID 80527462) has the molecular formula C15H24N2OS2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-carbamothioyl-2-ethyl-N-(2-methyl-2-thiophen-2-ylpropyl)butanamide.
| Compound Name | 2-carbamothioyl-2-ethyl-N-(2-methyl-2-thiophen-2-ylpropyl)butanamide |
|---|---|
| PubChem CID | 80527462 |
| Molecular Formula | C15H24N2OS2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-carbamothioyl-2-ethyl-N-(2-methyl-2-thiophen-2-ylpropyl)butanamide |
| SMILES | CCC(CC)(C(=O)NCC(C)(C)c1cccs1)C(N)=S |
| InChI | InChI=1S/C15H24N2OS2/c1-5-15(6-2,12(16)19)13(18)17-10-14(3,4)11-8-7-9-20-11/h7-9H,5-6,10H2,1-4H3,(H2,16,19)(H,17,18) |
| InChIKey | PMSXACHQBCFWQE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|