C11H19NOS2 — CID 64652385
N-ethyl-5-thiophen-2-ylsulfinylpentan-2-amine (PubChem CID 64652385) has the molecular formula C11H19NOS2 and a molecular weight of 245.41 g/mol. Its IUPAC name is N-ethyl-5-thiophen-2-ylsulfinylpentan-2-amine.
| Compound Name | N-ethyl-5-thiophen-2-ylsulfinylpentan-2-amine |
|---|---|
| PubChem CID | 64652385 |
| Molecular Formula | C11H19NOS2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-ethyl-5-thiophen-2-ylsulfinylpentan-2-amine |
| SMILES | CCNC(C)CCCS(=O)c1cccs1 |
| InChI | InChI=1S/C11H19NOS2/c1-3-12-10(2)6-5-9-15(13)11-7-4-8-14-11/h4,7-8,10,12H,3,5-6,9H2,1-2H3 |
| InChIKey | MXIOPPFAQLHXAD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |