C9H15NOS2 — CID 64652798
1-thiophen-2-ylsulfinylpentan-2-amine (PubChem CID 64652798) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfinylpentan-2-amine.
| Compound Name | 1-thiophen-2-ylsulfinylpentan-2-amine |
|---|---|
| PubChem CID | 64652798 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-thiophen-2-ylsulfinylpentan-2-amine |
| SMILES | CCCC(N)CS(=O)c1cccs1 |
| InChI | InChI=1S/C9H15NOS2/c1-2-4-8(10)7-13(11)9-5-3-6-12-9/h3,5-6,8H,2,4,7,10H2,1H3 |
| InChIKey | DFIDZRGHAOYSHB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |