C10H17NOS2 — CID 64654040
N-propyl-3-thiophen-2-ylsulfinylpropan-1-amine (PubChem CID 64654040) has the molecular formula C10H17NOS2 and a molecular weight of 231.39 g/mol. Its IUPAC name is N-propyl-3-thiophen-2-ylsulfinylpropan-1-amine.
| Compound Name | N-propyl-3-thiophen-2-ylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 64654040 |
| Molecular Formula | C10H17NOS2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-propyl-3-thiophen-2-ylsulfinylpropan-1-amine |
| SMILES | CCCNCCCS(=O)c1cccs1 |
| InChI | InChI=1S/C10H17NOS2/c1-2-6-11-7-4-9-14(12)10-5-3-8-13-10/h3,5,8,11H,2,4,6-7,9H2,1H3 |
| InChIKey | KTPWMJUPIMVCKB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|