C13H15F2NS — CID 65257227
5-(2,5-difluorophenyl)sulfanyl-2,2-dimethylpentanenitrile (PubChem CID 65257227) has the molecular formula C13H15F2NS and a molecular weight of 255.33 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfanyl-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,5-difluorophenyl)sulfanyl-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65257227 |
| Molecular Formula | C13H15F2NS |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfanyl-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCSc1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NS/c1-13(2,9-16)6-3-7-17-12-8-10(14)4-5-11(12)15/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | GLWAHSSUCMXXHG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|