C12H15ClN2S — CID 65253182
4-(2-amino-4-chlorophenyl)sulfanyl-2,2-dimethylbutanenitrile (PubChem CID 65253182) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 4-(2-amino-4-chlorophenyl)sulfanyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2-amino-4-chlorophenyl)sulfanyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65253182 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-(2-amino-4-chlorophenyl)sulfanyl-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCSc1ccc(Cl)cc1N |
| InChI | InChI=1S/C12H15ClN2S/c1-12(2,8-14)5-6-16-11-4-3-9(13)7-10(11)15/h3-4,7H,5-6,15H2,1-2H3 |
| InChIKey | PWASSJQSNAESJZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|