C11H15F2NOS — CID 64652840
5-(2,4-difluorophenyl)sulfinylpentan-2-amine (PubChem CID 64652840) has the molecular formula C11H15F2NOS and a molecular weight of 247.31 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)sulfinylpentan-2-amine.
| Compound Name | 5-(2,4-difluorophenyl)sulfinylpentan-2-amine |
|---|---|
| PubChem CID | 64652840 |
| Molecular Formula | C11H15F2NOS |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 5-(2,4-difluorophenyl)sulfinylpentan-2-amine |
| SMILES | CC(N)CCCS(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H15F2NOS/c1-8(14)3-2-6-16(15)11-5-4-9(12)7-10(11)13/h4-5,7-8H,2-3,6,14H2,1H3 |
| InChIKey | CGSSXDNOBINETA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |