C15H21F2NOS — CID 104754680
1-cyclopentyl-2-(2,5-difluorophenyl)sulfinyl-N-ethylethanamine (PubChem CID 104754680) has the molecular formula C15H21F2NOS and a molecular weight of 301.40 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,5-difluorophenyl)sulfinyl-N-ethylethanamine.
| Compound Name | 1-cyclopentyl-2-(2,5-difluorophenyl)sulfinyl-N-ethylethanamine |
|---|---|
| PubChem CID | 104754680 |
| Molecular Formula | C15H21F2NOS |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-cyclopentyl-2-(2,5-difluorophenyl)sulfinyl-N-ethylethanamine |
| SMILES | CCNC(CS(=O)c1cc(F)ccc1F)C1CCCC1 |
| InChI | InChI=1S/C15H21F2NOS/c1-2-18-14(11-5-3-4-6-11)10-20(19)15-9-12(16)7-8-13(15)17/h7-9,11,14,18H,2-6,10H2,1H3 |
| InChIKey | BRZIUFOXAJPGDK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |