C11H18N4OS — CID 77064204
N'-hydroxy-2,2-dimethyl-5-pyrimidin-4-ylsulfanylpentanimidamide (PubChem CID 77064204) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-pyrimidin-4-ylsulfanylpentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-pyrimidin-4-ylsulfanylpentanimidamide |
|---|---|
| PubChem CID | 77064204 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-pyrimidin-4-ylsulfanylpentanimidamide |
| SMILES | CC(C)(CCCSc1ccncn1)C(N)=NO |
| InChI | InChI=1S/C11H18N4OS/c1-11(2,10(12)15-16)5-3-7-17-9-4-6-13-8-14-9/h4,6,8,16H,3,5,7H2,1-2H3,(H2,12,15) |
| InChIKey | RQEUFYGRUZVINY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|