C12H15F2NO2S — CID 55145519
ethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate (PubChem CID 55145519) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is ethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate.
| Compound Name | ethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 55145519 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | ethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate |
| SMILES | CCOC(=O)C(N)CCSc1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2NO2S/c1-2-17-12(16)10(15)5-6-18-11-7-8(13)3-4-9(11)14/h3-4,7,10H,2,5-6,15H2,1H3 |
| InChIKey | QUQFYKQZPFRBBA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |