methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate

C11H13F2NO2S — CID 63034697

IUPACmethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate
SMILESCOC(=O)C(N)CCSc1cc(F)ccc1F
InChIInChI=1S/C11H13F2NO2S/c1-16-11(15)9(14)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9H,4-5,14H2,1H3
InChIKeyOERQFVQLXYBNEK-UHFFFAOYSA-N
MW261.29 g/mol
LogP1.95
Rot. Bonds5

About methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate

methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate (PubChem CID 63034697) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate.

Molecular Properties

Compound Namemethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate
PubChem CID63034697
Molecular FormulaC11H13F2NO2S
Molecular Weight261.29 g/mol
Exact Mass261.06
IUPAC Namemethyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate
SMILESCOC(=O)C(N)CCSc1cc(F)ccc1F
InChIInChI=1S/C11H13F2NO2S/c1-16-11(15)9(14)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9H,4-5,14H2,1H3
InChIKeyOERQFVQLXYBNEK-UHFFFAOYSA-N
XLogP1.95
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.29
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate?
The IUPAC name of methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate (CID 63034697) is methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate.
What is the SMILES notation for methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate?
The canonical SMILES for methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate is COC(=O)C(N)CCSc1cc(F)ccc1F.
What is the InChIKey of methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate?
The InChIKey is OERQFVQLXYBNEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO2S/c1-16-11(15)9(14)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9H,4-5,14H2,1H3.
What are the key properties of methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate?
methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate has a molecular weight of 261.29 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-(2,5-difluorophenyl)sulfanylbutanoate is sourced from PubChem (CID 63034697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).