C14H18FNO3S — CID 66362967
methyl 2-amino-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]butanoate (PubChem CID 66362967) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 2-amino-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]butanoate.
| Compound Name | methyl 2-amino-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 66362967 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl 2-amino-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]butanoate |
| SMILES | COC(=O)C(N)CCSCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C14H18FNO3S/c1-18-14(17)12(16)4-5-20-8-11-7-9-6-10(15)2-3-13(9)19-11/h2-3,6,11-12H,4-5,7-8,16H2,1H3 |
| InChIKey | VJVUUIMSCWYWHV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|