C14H19F2NO2S — CID 63033799
ethyl 4-(2,5-difluorophenyl)sulfanyl-2-(ethylamino)butanoate (PubChem CID 63033799) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is ethyl 4-(2,5-difluorophenyl)sulfanyl-2-(ethylamino)butanoate.
| Compound Name | ethyl 4-(2,5-difluorophenyl)sulfanyl-2-(ethylamino)butanoate |
|---|---|
| PubChem CID | 63033799 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | ethyl 4-(2,5-difluorophenyl)sulfanyl-2-(ethylamino)butanoate |
| SMILES | CCNC(CCSc1cc(F)ccc1F)C(=O)OCC |
| InChI | InChI=1S/C14H19F2NO2S/c1-3-17-12(14(18)19-4-2)7-8-20-13-9-10(15)5-6-11(13)16/h5-6,9,12,17H,3-4,7-8H2,1-2H3 |
| InChIKey | MULOGRGEYWJYOP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |