C15H21F2NO2S — CID 63033565
ethyl 4-(3,4-difluorophenyl)sulfanyl-2-(propylamino)butanoate (PubChem CID 63033565) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is ethyl 4-(3,4-difluorophenyl)sulfanyl-2-(propylamino)butanoate.
| Compound Name | ethyl 4-(3,4-difluorophenyl)sulfanyl-2-(propylamino)butanoate |
|---|---|
| PubChem CID | 63033565 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl 4-(3,4-difluorophenyl)sulfanyl-2-(propylamino)butanoate |
| SMILES | CCCNC(CCSc1ccc(F)c(F)c1)C(=O)OCC |
| InChI | InChI=1S/C15H21F2NO2S/c1-3-8-18-14(15(19)20-4-2)7-9-21-11-5-6-12(16)13(17)10-11/h5-6,10,14,18H,3-4,7-9H2,1-2H3 |
| InChIKey | OQSGLCYZHBDXGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |