C14H17F2NO3S — CID 107563664
(2R)-2-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]pentanoic acid (PubChem CID 107563664) has the molecular formula C14H17F2NO3S and a molecular weight of 317.36 g/mol. Its IUPAC name is (2R)-2-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]pentanoic acid.
| Compound Name | (2R)-2-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107563664 |
| Molecular Formula | C14H17F2NO3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2R)-2-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)CCSc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H17F2NO3S/c1-2-3-12(14(19)20)17-13(18)6-7-21-9-4-5-10(15)11(16)8-9/h4-5,8,12H,2-3,6-7H2,1H3,(H,17,18)(H,19,20)/t12-/m1/s1 |
| InChIKey | HTNRBRCBSPJCQG-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |