C13H17F2NOS — CID 60666996
N-tert-butyl-3-(3,4-difluorophenyl)sulfanylpropanamide (PubChem CID 60666996) has the molecular formula C13H17F2NOS and a molecular weight of 273.35 g/mol. Its IUPAC name is N-tert-butyl-3-(3,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-tert-butyl-3-(3,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 60666996 |
| Molecular Formula | C13H17F2NOS |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-tert-butyl-3-(3,4-difluorophenyl)sulfanylpropanamide |
| SMILES | CC(C)(C)NC(=O)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NOS/c1-13(2,3)16-12(17)6-7-18-9-4-5-10(14)11(15)8-9/h4-5,8H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | GJGKMLVZDBJLMT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |