C11H12F2OS — CID 43425972
5-(3,4-difluorophenyl)sulfanylpentan-2-one (PubChem CID 43425972) has the molecular formula C11H12F2OS and a molecular weight of 230.28 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)sulfanylpentan-2-one.
| Compound Name | 5-(3,4-difluorophenyl)sulfanylpentan-2-one |
|---|---|
| PubChem CID | 43425972 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-(3,4-difluorophenyl)sulfanylpentan-2-one |
| SMILES | CC(=O)CCCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2OS/c1-8(14)3-2-6-15-9-4-5-10(12)11(13)7-9/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | ZSEHOMCKADHUAC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|