C11H15F2NS — CID 64615787
5-(3,4-difluorophenyl)sulfanylpentan-2-amine (PubChem CID 64615787) has the molecular formula C11H15F2NS and a molecular weight of 231.31 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)sulfanylpentan-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)sulfanylpentan-2-amine |
|---|---|
| PubChem CID | 64615787 |
| Molecular Formula | C11H15F2NS |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-(3,4-difluorophenyl)sulfanylpentan-2-amine |
| SMILES | CC(N)CCCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H15F2NS/c1-8(14)3-2-6-15-9-4-5-10(12)11(13)7-9/h4-5,7-8H,2-3,6,14H2,1H3 |
| InChIKey | LQXZRKQFHGOSEH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|