C10H12F2N2OS — CID 63033564
2-amino-4-(3,4-difluorophenyl)sulfanylbutanamide (PubChem CID 63033564) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-amino-4-(3,4-difluorophenyl)sulfanylbutanamide.
| Compound Name | 2-amino-4-(3,4-difluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 63033564 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-amino-4-(3,4-difluorophenyl)sulfanylbutanamide |
| SMILES | NC(=O)C(N)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2OS/c11-7-2-1-6(5-8(7)12)16-4-3-9(13)10(14)15/h1-2,5,9H,3-4,13H2,(H2,14,15) |
| InChIKey | FTBVVFCHARWZQZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |