C10H12F2N2O2 — CID 63038942
2-amino-4-(2,4-difluorophenoxy)butanamide (PubChem CID 63038942) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-amino-4-(2,4-difluorophenoxy)butanamide.
| Compound Name | 2-amino-4-(2,4-difluorophenoxy)butanamide |
|---|---|
| PubChem CID | 63038942 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-amino-4-(2,4-difluorophenoxy)butanamide |
| SMILES | NC(=O)C(N)CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O2/c11-6-1-2-9(7(12)5-6)16-4-3-8(13)10(14)15/h1-2,5,8H,3-4,13H2,(H2,14,15) |
| InChIKey | JRNPEVORRNBGSX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |