C12H15F2NO3 — CID 63039133
methyl 4-(2,4-difluorophenoxy)-2-(methylamino)butanoate (PubChem CID 63039133) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is methyl 4-(2,4-difluorophenoxy)-2-(methylamino)butanoate.
| Compound Name | methyl 4-(2,4-difluorophenoxy)-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 63039133 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl 4-(2,4-difluorophenoxy)-2-(methylamino)butanoate |
| SMILES | CNC(CCOc1ccc(F)cc1F)C(=O)OC |
| InChI | InChI=1S/C12H15F2NO3/c1-15-10(12(16)17-2)5-6-18-11-4-3-8(13)7-9(11)14/h3-4,7,10,15H,5-6H2,1-2H3 |
| InChIKey | KCSODOLCXMIYBL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |