C10H14ClF2NO — CID 86262593
4-(2,4-difluorophenoxy)butan-1-amine;hydrochloride (PubChem CID 86262593) has the molecular formula C10H14ClF2NO and a molecular weight of 237.68 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)butan-1-amine;hydrochloride.
| Compound Name | 4-(2,4-difluorophenoxy)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262593 |
| Molecular Formula | C10H14ClF2NO |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-(2,4-difluorophenoxy)butan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C10H13F2NO.ClH/c11-8-3-4-10(9(12)7-8)14-6-2-1-5-13;/h3-4,7H,1-2,5-6,13H2;1H |
| InChIKey | OTQWFPMVPFFJQN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|