C9H9F3O3S — CID 165461012
3-(2,4-difluorophenoxy)propane-1-sulfonyl fluoride (PubChem CID 165461012) has the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)propane-1-sulfonyl fluoride.
| Compound Name | 3-(2,4-difluorophenoxy)propane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 165461012 |
| Molecular Formula | C9H9F3O3S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-(2,4-difluorophenoxy)propane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)CCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F3O3S/c10-7-2-3-9(8(11)6-7)15-4-1-5-16(12,13)14/h2-3,6H,1,4-5H2 |
| InChIKey | JDWDBPPGPYVLJQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|