C11H14BrFO3S — CID 107699042
2-(bromomethyl)-4-fluoro-1-(3-methylsulfonylpropoxy)benzene (PubChem CID 107699042) has the molecular formula C11H14BrFO3S and a molecular weight of 325.20 g/mol. Its IUPAC name is 2-(bromomethyl)-4-fluoro-1-(3-methylsulfonylpropoxy)benzene.
| Compound Name | 2-(bromomethyl)-4-fluoro-1-(3-methylsulfonylpropoxy)benzene |
|---|---|
| PubChem CID | 107699042 |
| Molecular Formula | C11H14BrFO3S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 2-(bromomethyl)-4-fluoro-1-(3-methylsulfonylpropoxy)benzene |
| SMILES | CS(=O)(=O)CCCOc1ccc(F)cc1CBr |
| InChI | InChI=1S/C11H14BrFO3S/c1-17(14,15)6-2-5-16-11-4-3-10(13)7-9(11)8-12/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | ZWKRTMGPMHCPSS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|