C9H8BrF3O — CID 107699186
2-(bromomethyl)-1-(2,2-difluoroethoxy)-4-fluorobenzene (PubChem CID 107699186) has the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. Its IUPAC name is 2-(bromomethyl)-1-(2,2-difluoroethoxy)-4-fluorobenzene.
| Compound Name | 2-(bromomethyl)-1-(2,2-difluoroethoxy)-4-fluorobenzene |
|---|---|
| PubChem CID | 107699186 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-(bromomethyl)-1-(2,2-difluoroethoxy)-4-fluorobenzene |
| SMILES | Fc1ccc(OCC(F)F)c(CBr)c1 |
| InChI | InChI=1S/C9H8BrF3O/c10-4-6-3-7(11)1-2-8(6)14-5-9(12)13/h1-3,9H,4-5H2 |
| InChIKey | WIWKLOFXLKFEHW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|