C12H17F2NO2 — CID 64804927
4-(2,4-difluorophenoxy)-2-(ethylamino)butan-1-ol (PubChem CID 64804927) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-2-(ethylamino)butan-1-ol.
| Compound Name | 4-(2,4-difluorophenoxy)-2-(ethylamino)butan-1-ol |
|---|---|
| PubChem CID | 64804927 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-2-(ethylamino)butan-1-ol |
| SMILES | CCNC(CO)CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C12H17F2NO2/c1-2-15-10(8-16)5-6-17-12-4-3-9(13)7-11(12)14/h3-4,7,10,15-16H,2,5-6,8H2,1H3 |
| InChIKey | CMKDZEROMMONOA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |