C13H18N2OS — CID 63033798
2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanamide (PubChem CID 63033798) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanamide.
| Compound Name | 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 63033798 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanamide |
| SMILES | NC(=O)C(N)CCSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H18N2OS/c14-12(13(15)16)6-7-17-11-5-4-9-2-1-3-10(9)8-11/h4-5,8,12H,1-3,6-7,14H2,(H2,15,16) |
| InChIKey | WRJCGGUMISUDDW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |