C12H16S2 — CID 117033721
2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)ethanethiol (PubChem CID 117033721) has the molecular formula C12H16S2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)ethanethiol.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)ethanethiol |
|---|---|
| PubChem CID | 117033721 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)ethanethiol |
| SMILES | SCCSc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H16S2/c13-7-8-14-12-6-5-10-3-1-2-4-11(10)9-12/h5-6,9,13H,1-4,7-8H2 |
| InChIKey | FNZIHVMRMSFFAW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|