C13H17ClS — CID 63499850
5-(4-chlorobutylsulfanyl)-2,3-dihydro-1H-indene (PubChem CID 63499850) has the molecular formula C13H17ClS and a molecular weight of 240.80 g/mol. Its IUPAC name is 5-(4-chlorobutylsulfanyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(4-chlorobutylsulfanyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63499850 |
| Molecular Formula | C13H17ClS |
| Molecular Weight | 240.80 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-(4-chlorobutylsulfanyl)-2,3-dihydro-1H-indene |
| SMILES | ClCCCCSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H17ClS/c14-8-1-2-9-15-13-7-6-11-4-3-5-12(11)10-13/h6-7,10H,1-5,8-9H2 |
| InChIKey | ZSDFOIMEJNYXAF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|