C17H27NOS — CID 106810962
5-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-ethyl-2-(methylamino)pentan-1-ol (PubChem CID 106810962) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-ethyl-2-(methylamino)pentan-1-ol.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-ethyl-2-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810962 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-ethyl-2-(methylamino)pentan-1-ol |
| SMILES | CCC(CO)(CCCSc1ccc2c(c1)CCC2)NC |
| InChI | InChI=1S/C17H27NOS/c1-3-17(13-19,18-2)10-5-11-20-16-9-8-14-6-4-7-15(14)12-16/h8-9,12,18-19H,3-7,10-11,13H2,1-2H3 |
| InChIKey | OHGJHOHEUGSMER-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|