C15H21NO2S — CID 63034861
ethyl 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanoate (PubChem CID 63034861) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is ethyl 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanoate.
| Compound Name | ethyl 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 63034861 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | ethyl 2-amino-4-(2,3-dihydro-1H-inden-5-ylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(N)CCSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21NO2S/c1-2-18-15(17)14(16)8-9-19-13-7-6-11-4-3-5-12(11)10-13/h6-7,10,14H,2-5,8-9,16H2,1H3 |
| InChIKey | QFMVLRDAXHMZPH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |