About ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate
ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate (PubChem CID 116914231) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate.
Analyze ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate?
The IUPAC name of ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate (CID 116914231) is ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate.
What is the SMILES notation for ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate?
The canonical SMILES for ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate is CCOC(=O)C(c1ccc2c(c1)CCC2)N(C)C.
What is the InChIKey of ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate?
The InChIKey is NLWJQFUAOZEJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-4-18-15(17)14(16(2)3)13-9-8-11-6-5-7-12(11)10-13/h8-10,14H,4-7H2,1-3H3.
What are the key properties of ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate?
ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate has a molecular weight of 247.34 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,3-dihydro-1H-inden-5-yl)-2-(dimethylamino)acetate is sourced from PubChem (CID 116914231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).