C13H19F2NOS — CID 64819699
4-(3,4-difluorophenyl)sulfanyl-2-(propan-2-ylamino)butan-1-ol (PubChem CID 64819699) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-2-(propan-2-ylamino)butan-1-ol.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-2-(propan-2-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 64819699 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-2-(propan-2-ylamino)butan-1-ol |
| SMILES | CC(C)NC(CO)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2NOS/c1-9(2)16-10(8-17)5-6-18-11-3-4-12(14)13(15)7-11/h3-4,7,9-10,16-17H,5-6,8H2,1-2H3 |
| InChIKey | MOAUSZTYXBDMJZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |